C16H12F6N2O4S — CID 2080031
2-[3,5-bis(trifluoromethyl)phenoxy]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 2080031) has the molecular formula C16H12F6N2O4S and a molecular weight of 442.34 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 2080031 |
| Molecular Formula | C16H12F6N2O4S |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H12F6N2O4S/c17-15(18,19)9-5-10(16(20,21)22)7-12(6-9)28-8-14(25)24-11-1-3-13(4-2-11)29(23,26)27/h1-7H,8H2,(H,24,25)(H2,23,26,27) |
| InChIKey | PSGIVLHEELEYPE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |