C19H16F6N2O3 — CID 112836068
4-[[2-[3,5-bis(trifluoromethyl)phenoxy]acetyl]amino]-N-ethylbenzamide (PubChem CID 112836068) has the molecular formula C19H16F6N2O3 and a molecular weight of 434.34 g/mol. Its IUPAC name is 4-[[2-[3,5-bis(trifluoromethyl)phenoxy]acetyl]amino]-N-ethylbenzamide.
| Compound Name | 4-[[2-[3,5-bis(trifluoromethyl)phenoxy]acetyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 112836068 |
| Molecular Formula | C19H16F6N2O3 |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 4-[[2-[3,5-bis(trifluoromethyl)phenoxy]acetyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)COc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H16F6N2O3/c1-2-26-17(29)11-3-5-14(6-4-11)27-16(28)10-30-15-8-12(18(20,21)22)7-13(9-15)19(23,24)25/h3-9H,2,10H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | FGPHHBNVFCAHJP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |