C13H16N2O4 — CID 28638135
methyl 3-[4-(ethylcarbamoyl)anilino]-3-oxopropanoate (PubChem CID 28638135) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 3-[4-(ethylcarbamoyl)anilino]-3-oxopropanoate.
| Compound Name | methyl 3-[4-(ethylcarbamoyl)anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 28638135 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | methyl 3-[4-(ethylcarbamoyl)anilino]-3-oxopropanoate |
| SMILES | CCNC(=O)c1ccc(NC(=O)CC(=O)OC)cc1 |
| InChI | InChI=1S/C13H16N2O4/c1-3-14-13(18)9-4-6-10(7-5-9)15-11(16)8-12(17)19-2/h4-7H,3,8H2,1-2H3,(H,14,18)(H,15,16) |
| InChIKey | YOUIBTCCHBHXEU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|