C13H20N2O3 — CID 142227182
[4-(ethylcarbamoyl)phenyl]carbamic acid;propane (PubChem CID 142227182) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is [4-(ethylcarbamoyl)phenyl]carbamic acid;propane.
| Compound Name | [4-(ethylcarbamoyl)phenyl]carbamic acid;propane |
|---|---|
| PubChem CID | 142227182 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | [4-(ethylcarbamoyl)phenyl]carbamic acid;propane |
| SMILES | CCC.CCNC(=O)c1ccc(NC(=O)O)cc1 |
| InChI | InChI=1S/C10H12N2O3.C3H8/c1-2-11-9(13)7-3-5-8(6-4-7)12-10(14)15;1-3-2/h3-6,12H,2H2,1H3,(H,11,13)(H,14,15);3H2,1-2H3 |
| InChIKey | XEJXLXTXGLOERI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |