C19H16F6N2O5S — CID 2337896
[2-[3,5-bis(trifluoromethyl)anilino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate (PubChem CID 2337896) has the molecular formula C19H16F6N2O5S and a molecular weight of 498.40 g/mol. Its IUPAC name is [2-[3,5-bis(trifluoromethyl)anilino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-[3,5-bis(trifluoromethyl)anilino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2337896 |
| Molecular Formula | C19H16F6N2O5S |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | [2-[3,5-bis(trifluoromethyl)anilino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)OCC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H16F6N2O5S/c1-27(2)33(30,31)15-5-3-4-11(6-15)17(29)32-10-16(28)26-14-8-12(18(20,21)22)7-13(9-14)19(23,24)25/h3-9H,10H2,1-2H3,(H,26,28) |
| InChIKey | YKFBOIGYRXNXEX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |