C17H13F6NO2 — CID 108795497
N-[3,5-bis(trifluoromethyl)phenyl]-3-phenoxypropanamide (PubChem CID 108795497) has the molecular formula C17H13F6NO2 and a molecular weight of 377.28 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-3-phenoxypropanamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 108795497 |
| Molecular Formula | C17H13F6NO2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-3-phenoxypropanamide |
| SMILES | O=C(CCOc1ccccc1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F6NO2/c18-16(19,20)11-8-12(17(21,22)23)10-13(9-11)24-15(25)6-7-26-14-4-2-1-3-5-14/h1-5,8-10H,6-7H2,(H,24,25) |
| InChIKey | DVIPDFSQLBZAOO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |