C17H16F3NO4 — CID 66876567
phenyl N-[3-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]carbamate (PubChem CID 66876567) has the molecular formula C17H16F3NO4 and a molecular weight of 355.31 g/mol. Its IUPAC name is phenyl N-[3-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]carbamate.
| Compound Name | phenyl N-[3-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 66876567 |
| Molecular Formula | C17H16F3NO4 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | phenyl N-[3-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]carbamate |
| SMILES | COCCOc1cc(NC(=O)Oc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3NO4/c1-23-7-8-24-15-10-12(17(18,19)20)9-13(11-15)21-16(22)25-14-5-3-2-4-6-14/h2-6,9-11H,7-8H2,1H3,(H,21,22) |
| InChIKey | USLYFFWVTFLIBI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|