C16H10F6N2O2S — CID 2820524
phenyl N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]carbamate (PubChem CID 2820524) has the molecular formula C16H10F6N2O2S and a molecular weight of 408.32 g/mol. Its IUPAC name is phenyl N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]carbamate.
| Compound Name | phenyl N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 2820524 |
| Molecular Formula | C16H10F6N2O2S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | phenyl N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]carbamate |
| SMILES | O=C(NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Oc1ccccc1 |
| InChI | InChI=1S/C16H10F6N2O2S/c17-15(18,19)9-6-10(16(20,21)22)8-11(7-9)23-13(27)24-14(25)26-12-4-2-1-3-5-12/h1-8H,(H2,23,24,25,27) |
| InChIKey | CTUJEQGZRAJGHZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|