C19H20F3N3O2 — CID 118233827
phenyl N-[3-(piperazin-1-ylmethyl)-5-(trifluoromethyl)phenyl]carbamate (PubChem CID 118233827) has the molecular formula C19H20F3N3O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is phenyl N-[3-(piperazin-1-ylmethyl)-5-(trifluoromethyl)phenyl]carbamate.
| Compound Name | phenyl N-[3-(piperazin-1-ylmethyl)-5-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 118233827 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | phenyl N-[3-(piperazin-1-ylmethyl)-5-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1cc(CN2CCNCC2)cc(C(F)(F)F)c1)Oc1ccccc1 |
| InChI | InChI=1S/C19H20F3N3O2/c20-19(21,22)15-10-14(13-25-8-6-23-7-9-25)11-16(12-15)24-18(26)27-17-4-2-1-3-5-17/h1-5,10-12,23H,6-9,13H2,(H,24,26) |
| InChIKey | KPLZMTYOYBUBKO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |