C18H19F3N4O2 — CID 118233953
phenyl N-[6-(piperidin-4-ylamino)-4-(trifluoromethyl)-2-pyridinyl]carbamate (PubChem CID 118233953) has the molecular formula C18H19F3N4O2 and a molecular weight of 380.37 g/mol. Its IUPAC name is phenyl N-[6-(piperidin-4-ylamino)-4-(trifluoromethyl)-2-pyridinyl]carbamate.
| Compound Name | phenyl N-[6-(piperidin-4-ylamino)-4-(trifluoromethyl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 118233953 |
| Molecular Formula | C18H19F3N4O2 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | phenyl N-[6-(piperidin-4-ylamino)-4-(trifluoromethyl)-2-pyridinyl]carbamate |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(NC2CCNCC2)n1)Oc1ccccc1 |
| InChI | InChI=1S/C18H19F3N4O2/c19-18(20,21)12-10-15(23-13-6-8-22-9-7-13)24-16(11-12)25-17(26)27-14-4-2-1-3-5-14/h1-5,10-11,13,22H,6-9H2,(H2,23,24,25,26) |
| InChIKey | YIXKJHZLYVAKSO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |