C20H24N2O2S — CID 129311857
phenyl N-[3-tert-butyl-5-(cyclopropylsulfanylamino)phenyl]carbamate (PubChem CID 129311857) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is phenyl N-[3-tert-butyl-5-(cyclopropylsulfanylamino)phenyl]carbamate.
| Compound Name | phenyl N-[3-tert-butyl-5-(cyclopropylsulfanylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 129311857 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | phenyl N-[3-tert-butyl-5-(cyclopropylsulfanylamino)phenyl]carbamate |
| SMILES | CC(C)(C)c1cc(NSC2CC2)cc(NC(=O)Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H24N2O2S/c1-20(2,3)14-11-15(13-16(12-14)22-25-18-9-10-18)21-19(23)24-17-7-5-4-6-8-17/h4-8,11-13,18,22H,9-10H2,1-3H3,(H,21,23) |
| InChIKey | WQXPXNTUNFDPFB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|