C20H27N3O2 — CID 67159405
phenyl N-(3-tert-butyl-1-cyclohexylpyrazol-5-yl)carbamate (PubChem CID 67159405) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is phenyl N-(3-tert-butyl-1-cyclohexylpyrazol-5-yl)carbamate.
| Compound Name | phenyl N-(3-tert-butyl-1-cyclohexylpyrazol-5-yl)carbamate |
|---|---|
| PubChem CID | 67159405 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | phenyl N-(3-tert-butyl-1-cyclohexylpyrazol-5-yl)carbamate |
| SMILES | CC(C)(C)c1cc(NC(=O)Oc2ccccc2)n(C2CCCCC2)n1 |
| InChI | InChI=1S/C20H27N3O2/c1-20(2,3)17-14-18(23(22-17)15-10-6-4-7-11-15)21-19(24)25-16-12-8-5-9-13-16/h5,8-9,12-15H,4,6-7,10-11H2,1-3H3,(H,21,24) |
| InChIKey | JPTJMZPXBCLLLE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |