C13H21N3O3S — CID 97028513
N-[3-tert-butyl-1-[(3R)-1,1-dioxothiolan-3-yl]pyrazol-5-yl]acetamide (PubChem CID 97028513) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is N-[3-tert-butyl-1-[(3R)-1,1-dioxothiolan-3-yl]pyrazol-5-yl]acetamide.
| Compound Name | N-[3-tert-butyl-1-[(3R)-1,1-dioxothiolan-3-yl]pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 97028513 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[3-tert-butyl-1-[(3R)-1,1-dioxothiolan-3-yl]pyrazol-5-yl]acetamide |
| SMILES | CC(=O)Nc1cc(C(C)(C)C)nn1[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H21N3O3S/c1-9(17)14-12-7-11(13(2,3)4)15-16(12)10-5-6-20(18,19)8-10/h7,10H,5-6,8H2,1-4H3,(H,14,17)/t10-/m1/s1 |
| InChIKey | XPGHCDUCLBUZLQ-SNVBAGLBSA-N |
| XLogP | 1.50 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |