C18H22FN3O3S — CID 25471752
N-[3-tert-butyl-1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-5-yl]-3-fluorobenzamide (PubChem CID 25471752) has the molecular formula C18H22FN3O3S and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[3-tert-butyl-1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-5-yl]-3-fluorobenzamide.
| Compound Name | N-[3-tert-butyl-1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-5-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 25471752 |
| Molecular Formula | C18H22FN3O3S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[3-tert-butyl-1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-5-yl]-3-fluorobenzamide |
| SMILES | CC(C)(C)c1cc(NC(=O)c2cccc(F)c2)n([C@H]2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C18H22FN3O3S/c1-18(2,3)15-10-16(20-17(23)12-5-4-6-13(19)9-12)22(21-15)14-7-8-26(24,25)11-14/h4-6,9-10,14H,7-8,11H2,1-3H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | MZTMIYIEYNCOLJ-AWEZNQCLSA-N |
| XLogP | 2.93 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |