C15H26N2O2S — CID 43531676
3-(3,5-ditert-butylpyrazol-1-yl)thiolane 1,1-dioxide (PubChem CID 43531676) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 3-(3,5-ditert-butylpyrazol-1-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(3,5-ditert-butylpyrazol-1-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 43531676 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-(3,5-ditert-butylpyrazol-1-yl)thiolane 1,1-dioxide |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)n(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C15H26N2O2S/c1-14(2,3)12-9-13(15(4,5)6)17(16-12)11-7-8-20(18,19)10-11/h9,11H,7-8,10H2,1-6H3 |
| InChIKey | TZALXXGOPAKSRZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |