C17H15N3O4 — CID 110715408
phenyl N-[3-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]carbamate (PubChem CID 110715408) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is phenyl N-[3-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]carbamate.
| Compound Name | phenyl N-[3-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 110715408 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | phenyl N-[3-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]carbamate |
| SMILES | CN1C(=O)NC(c2cccc(NC(=O)Oc3ccccc3)c2)C1=O |
| InChI | InChI=1S/C17H15N3O4/c1-20-15(21)14(19-16(20)22)11-6-5-7-12(10-11)18-17(23)24-13-8-3-2-4-9-13/h2-10,14H,1H3,(H,18,23)(H,19,22) |
| InChIKey | AFEABWLQMYRFHA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|