C20H21NO2 — CID 7011642
[3-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]phenyl] N-phenylcarbamate (PubChem CID 7011642) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is [3-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]phenyl] N-phenylcarbamate.
| Compound Name | [3-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]phenyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 7011642 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | [3-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]phenyl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)Oc1cccc([C@H]2C[C@@H]3CC[C@@H]2C3)c1 |
| InChI | InChI=1S/C20H21NO2/c22-20(21-17-6-2-1-3-7-17)23-18-8-4-5-15(13-18)19-12-14-9-10-16(19)11-14/h1-8,13-14,16,19H,9-12H2,(H,21,22)/t14-,16-,19-/m1/s1 |
| InChIKey | FCWHDSZGWRJEIK-IDHHARJASA-N |
| XLogP | 5.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |