C23H27NO2 — CID 7688468
[4-[(1R,2S,4S,5R)-5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl]phenyl] N-phenylcarbamate (PubChem CID 7688468) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is [4-[(1R,2S,4S,5R)-5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl]phenyl] N-phenylcarbamate.
| Compound Name | [4-[(1R,2S,4S,5R)-5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl]phenyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 7688468 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | [4-[(1R,2S,4S,5R)-5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl]phenyl] N-phenylcarbamate |
| SMILES | C[C@@H]1[C@@H]2C[C@H](c3ccc(OC(=O)Nc4ccccc4)cc3)[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C23H27NO2/c1-15-17-13-20(21(14-17)23(15,2)3)16-9-11-19(12-10-16)26-22(25)24-18-7-5-4-6-8-18/h4-12,15,17,20-21H,13-14H2,1-3H3,(H,24,25)/t15-,17-,20-,21-/m1/s1 |
| InChIKey | COBDRXXOEJTYQG-UAMLPYHUSA-N |
| XLogP | 6.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |