C15H17NO2 — CID 98073845
[(1R,3R,7R)-3-tricyclo[3.2.1.02,7]octanyl] N-phenylcarbamate (PubChem CID 98073845) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is [(1R,3R,7R)-3-tricyclo[3.2.1.02,7]octanyl] N-phenylcarbamate.
| Compound Name | [(1R,3R,7R)-3-tricyclo[3.2.1.02,7]octanyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 98073845 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | [(1R,3R,7R)-3-tricyclo[3.2.1.02,7]octanyl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O[C@@H]1CC2C[C@H]3C1[C@@H]3C2 |
| InChI | InChI=1S/C15H17NO2/c17-15(16-10-4-2-1-3-5-10)18-13-8-9-6-11-12(7-9)14(11)13/h1-5,9,11-14H,6-8H2,(H,16,17)/t9?,11-,12-,13-,14?/m1/s1 |
| InChIKey | DPTJUSUIZBCKDT-QLCGTBKRSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |