About [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate
[(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate (PubChem CID 139079563) has the molecular formula C20H22N2O4
and a molecular weight of 354.41 g/mol. Its IUPAC name is [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate.
Molecular Properties
| Compound Name | [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate |
| PubChem CID | 139079563 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O[C@@H]1CCC[C@H](OC(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C20H22N2O4/c23-19(21-15-8-3-1-4-9-15)25-17-12-7-13-18(14-17)26-20(24)22-16-10-5-2-6-11-16/h1-6,8-11,17-18H,7,12-14H2,(H,21,23)(H,22,24)/t17-,18+ |
| InChIKey | PCKYZSUVXNCHSI-HDICACEKSA-N |
| XLogP | 4.80 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate?
The IUPAC name of [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate (CID 139079563) is [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate.
What is the SMILES notation for [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate?
The canonical SMILES for [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate is O=C(Nc1ccccc1)O[C@@H]1CCC[C@H](OC(=O)Nc2ccccc2)C1.
What is the InChIKey of [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate?
The InChIKey is PCKYZSUVXNCHSI-HDICACEKSA-N. The full InChI is InChI=1S/C20H22N2O4/c23-19(21-15-8-3-1-4-9-15)25-17-12-7-13-18(14-17)26-20(24)22-16-10-5-2-6-11-16/h1-6,8-11,17-18H,7,12-14H2,(H,21,23)(H,22,24)/t17-,18+.
What are the key properties of [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate?
[(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate has a molecular weight of 354.41 g/mol, XLogP of 4.80, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate is sourced from PubChem (CID 139079563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).