C20H22N2O4 — CID 139079563
[(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate (PubChem CID 139079563) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate.
| Compound Name | [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 139079563 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [(1S,3R)-3-(phenylcarbamoyloxy)cyclohexyl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O[C@@H]1CCC[C@H](OC(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C20H22N2O4/c23-19(21-15-8-3-1-4-9-15)25-17-12-7-13-18(14-17)26-20(24)22-16-10-5-2-6-11-16/h1-6,8-11,17-18H,7,12-14H2,(H,21,23)(H,22,24)/t17-,18+ |
| InChIKey | PCKYZSUVXNCHSI-HDICACEKSA-N |
| XLogP | 4.80 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |