C15H23N3O4S — CID 95985836
[(1S,3R)-3-(dimethylsulfamoylamino)cyclohexyl] N-phenylcarbamate (PubChem CID 95985836) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is [(1S,3R)-3-(dimethylsulfamoylamino)cyclohexyl] N-phenylcarbamate.
| Compound Name | [(1S,3R)-3-(dimethylsulfamoylamino)cyclohexyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 95985836 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [(1S,3R)-3-(dimethylsulfamoylamino)cyclohexyl] N-phenylcarbamate |
| SMILES | CN(C)S(=O)(=O)N[C@@H]1CCC[C@H](OC(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C15H23N3O4S/c1-18(2)23(20,21)17-13-9-6-10-14(11-13)22-15(19)16-12-7-4-3-5-8-12/h3-5,7-8,13-14,17H,6,9-11H2,1-2H3,(H,16,19)/t13-,14+/m1/s1 |
| InChIKey | VUORTDQNNOZHSK-KGLIPLIRSA-N |
| XLogP | 1.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |