C19H23N3O3S — CID 71794298
[3-(thiophen-2-ylmethylcarbamoylamino)cyclohexyl] N-phenylcarbamate (PubChem CID 71794298) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is [3-(thiophen-2-ylmethylcarbamoylamino)cyclohexyl] N-phenylcarbamate.
| Compound Name | [3-(thiophen-2-ylmethylcarbamoylamino)cyclohexyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 71794298 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [3-(thiophen-2-ylmethylcarbamoylamino)cyclohexyl] N-phenylcarbamate |
| SMILES | O=C(NCc1cccs1)NC1CCCC(OC(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C19H23N3O3S/c23-18(20-13-17-10-5-11-26-17)21-15-8-4-9-16(12-15)25-19(24)22-14-6-2-1-3-7-14/h1-3,5-7,10-11,15-16H,4,8-9,12-13H2,(H,22,24)(H2,20,21,23) |
| InChIKey | IQFITEUTIVLWPL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |