C19H20N2O4 — CID 171976389
[1-(phenylcarbamoyloxy)cyclopentyl] N-phenylcarbamate (PubChem CID 171976389) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [1-(phenylcarbamoyloxy)cyclopentyl] N-phenylcarbamate.
| Compound Name | [1-(phenylcarbamoyloxy)cyclopentyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 171976389 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [1-(phenylcarbamoyloxy)cyclopentyl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OC1(OC(=O)Nc2ccccc2)CCCC1 |
| InChI | InChI=1S/C19H20N2O4/c22-17(20-15-9-3-1-4-10-15)24-19(13-7-8-14-19)25-18(23)21-16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2,(H,20,22)(H,21,23) |
| InChIKey | ATCYRWINDAXCJR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|