About 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate
2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate (PubChem CID 102321130) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate.
Molecular Properties
| Compound Name | 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate |
| PubChem CID | 102321130 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCC[C@]12CCCC[C@H]1O2 |
| InChI | InChI=1S/C15H19NO3/c17-14(16-12-6-2-1-3-7-12)18-11-10-15-9-5-4-8-13(15)19-15/h1-3,6-7,13H,4-5,8-11H2,(H,16,17)/t13-,15-/m1/s1 |
| InChIKey | NNYUPBMEJYWRCP-UKRRQHHQSA-N |
| XLogP | 3.34 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate?
The IUPAC name of 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate (CID 102321130) is 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate.
What is the SMILES notation for 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate?
The canonical SMILES for 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate is O=C(Nc1ccccc1)OCC[C@]12CCCC[C@H]1O2.
What is the InChIKey of 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate?
The InChIKey is NNYUPBMEJYWRCP-UKRRQHHQSA-N. The full InChI is InChI=1S/C15H19NO3/c17-14(16-12-6-2-1-3-7-12)18-11-10-15-9-5-4-8-13(15)19-15/h1-3,6-7,13H,4-5,8-11H2,(H,16,17)/t13-,15-/m1/s1.
What are the key properties of 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate?
2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate has a molecular weight of 261.32 g/mol, XLogP of 3.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethyl N-phenylcarbamate is sourced from PubChem (CID 102321130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).