C11H14NO5P — CID 23414889
2-(1,3,2-dioxaphospholan-2-yloxy)ethyl N-phenylcarbamate (PubChem CID 23414889) has the molecular formula C11H14NO5P and a molecular weight of 271.21 g/mol. Its IUPAC name is 2-(1,3,2-dioxaphospholan-2-yloxy)ethyl N-phenylcarbamate.
| Compound Name | 2-(1,3,2-dioxaphospholan-2-yloxy)ethyl N-phenylcarbamate |
|---|---|
| PubChem CID | 23414889 |
| Molecular Formula | C11H14NO5P |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-(1,3,2-dioxaphospholan-2-yloxy)ethyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCCOP1OCCO1 |
| InChI | InChI=1S/C11H14NO5P/c13-11(12-10-4-2-1-3-5-10)14-6-7-15-18-16-8-9-17-18/h1-5H,6-9H2,(H,12,13) |
| InChIKey | QVWSRXVXTDPNRJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|