C23H35NO3 — CID 11873349
2-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl N-phenylcarbamate (PubChem CID 11873349) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is 2-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl N-phenylcarbamate.
| Compound Name | 2-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl N-phenylcarbamate |
|---|---|
| PubChem CID | 11873349 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 2-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl N-phenylcarbamate |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H](CCOC(=O)Nc3ccccc3)[C@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C23H35NO3/c1-21(2)13-8-14-22(3)18(21)11-15-23(4,26)19(22)12-16-27-20(25)24-17-9-6-5-7-10-17/h5-7,9-10,18-19,26H,8,11-16H2,1-4H3,(H,24,25)/t18-,19+,22-,23+/m0/s1 |
| InChIKey | XEMYEKIWQRPWRD-JFSTXAPLSA-N |
| XLogP | 5.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |