C24H40O5 — CID 162921416
3-O-[5-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enyl] 1-O-methyl propanedioate (PubChem CID 162921416) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is 3-O-[5-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enyl] 1-O-methyl propanedioate.
| Compound Name | 3-O-[5-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enyl] 1-O-methyl propanedioate |
|---|---|
| PubChem CID | 162921416 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 3-O-[5-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-methylpent-2-enyl] 1-O-methyl propanedioate |
| SMILES | COC(=O)CC(=O)OCC=C(C)CCC1C(C)(O)CCC2C(C)(C)CCCC21C |
| InChI | InChI=1S/C24H40O5/c1-17(11-15-29-21(26)16-20(25)28-6)8-9-19-23(4)13-7-12-22(2,3)18(23)10-14-24(19,5)27/h11,18-19,27H,7-10,12-16H2,1-6H3 |
| InChIKey | BSFKELIWSIJBDC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|