C22H38O3 — CID 162994762
[(E)-5-[(1R,2S,4aR,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enyl] acetate (PubChem CID 162994762) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is [(E)-5-[(1R,2S,4aR,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enyl] acetate.
| Compound Name | [(E)-5-[(1R,2S,4aR,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enyl] acetate |
|---|---|
| PubChem CID | 162994762 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | [(E)-5-[(1R,2S,4aR,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC[C@@H]1[C@@]2(C)CCCC(C)(C)[C@H]2CC[C@]1(C)O |
| InChI | InChI=1S/C22H38O3/c1-16(11-15-25-17(2)23)8-9-19-21(5)13-7-12-20(3,4)18(21)10-14-22(19,6)24/h11,18-19,24H,7-10,12-15H2,1-6H3/b16-11+/t18-,19-,21+,22+/m1/s1 |
| InChIKey | GYGSQPMBVQQYCF-FPDCUTENSA-N |
| XLogP | 5.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|