C19H35N3O2 — CID 6303641
[(Z)-4-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)butan-2-ylideneamino]urea (PubChem CID 6303641) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is [(Z)-4-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)butan-2-ylideneamino]urea.
| Compound Name | [(Z)-4-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)butan-2-ylideneamino]urea |
|---|---|
| PubChem CID | 6303641 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | [(Z)-4-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)butan-2-ylideneamino]urea |
| SMILES | C/C(CCC1C(C)(O)CCC2C(C)(C)CCCC21C)=N/NC(N)=O |
| InChI | InChI=1S/C19H35N3O2/c1-13(21-22-16(20)23)7-8-15-18(4)11-6-10-17(2,3)14(18)9-12-19(15,5)24/h14-15,24H,6-12H2,1-5H3,(H3,20,22,23)/b21-13- |
| InChIKey | YPWULSVTTBGBFG-BKUYFWCQSA-N |
| XLogP | 3.80 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|