C29H46O3 — CID 163044778
[(3S)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentyl] 3-phenylpropanoate (PubChem CID 163044778) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is [(3S)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentyl] 3-phenylpropanoate.
| Compound Name | [(3S)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 163044778 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | [(3S)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentyl] 3-phenylpropanoate |
| SMILES | C[C@H](CCOC(=O)CCc1ccccc1)CC[C@@H]1[C@@]2(C)CCCC(C)(C)[C@@H]2CC[C@@]1(C)O |
| InChI | InChI=1S/C29H46O3/c1-22(17-21-32-26(30)15-13-23-10-7-6-8-11-23)12-14-25-28(4)19-9-18-27(2,3)24(28)16-20-29(25,5)31/h6-8,10-11,22,24-25,31H,9,12-21H2,1-5H3/t22-,24-,25+,28-,29+/m0/s1 |
| InChIKey | CPBRXCHKNTWHGL-USJFKKGGSA-N |
| XLogP | 6.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |