C23H34O3 — CID 11462498
2-[(2S,4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydrochromen-2-yl]ethyl 2-phenylacetate (PubChem CID 11462498) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 2-[(2S,4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydrochromen-2-yl]ethyl 2-phenylacetate.
| Compound Name | 2-[(2S,4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydrochromen-2-yl]ethyl 2-phenylacetate |
|---|---|
| PubChem CID | 11462498 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2-[(2S,4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydrochromen-2-yl]ethyl 2-phenylacetate |
| SMILES | CC1(C)CCC[C@]2(C)O[C@](C)(CCOC(=O)Cc3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C23H34O3/c1-21(2)12-8-13-23(4)19(21)11-14-22(3,26-23)15-16-25-20(24)17-18-9-6-5-7-10-18/h5-7,9-10,19H,8,11-17H2,1-4H3/t19-,22-,23-/m0/s1 |
| InChIKey | ANZNBJHFEMEASN-VJBMBRPKSA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |