C26H30O2 — CID 10785638
[(1'R,2'R,4'S)-1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-phenylacetate (PubChem CID 10785638) has the molecular formula C26H30O2 and a molecular weight of 374.52 g/mol. Its IUPAC name is [(1'R,2'R,4'S)-1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-phenylacetate.
| Compound Name | [(1'R,2'R,4'S)-1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 10785638 |
| Molecular Formula | C26H30O2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | [(1'R,2'R,4'S)-1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-phenylacetate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](OC(=O)Cc1ccccc1)C21Cc2ccccc2C1 |
| InChI | InChI=1S/C26H30O2/c1-24(2)21-13-14-25(24,3)23(28-22(27)15-18-9-5-4-6-10-18)26(21)16-19-11-7-8-12-20(19)17-26/h4-12,21,23H,13-17H2,1-3H3/t21-,23-,25-/m0/s1 |
| InChIKey | HBVYPPTYWWPNHC-RSEQLOHWSA-N |
| XLogP | 5.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |