C20H20O6 — CID 1106174
[(2S,3S)-3-(2-phenylacetyl)oxy-1,4-dioxan-2-yl] 2-phenylacetate (PubChem CID 1106174) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is [(2S,3S)-3-(2-phenylacetyl)oxy-1,4-dioxan-2-yl] 2-phenylacetate.
| Compound Name | [(2S,3S)-3-(2-phenylacetyl)oxy-1,4-dioxan-2-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 1106174 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [(2S,3S)-3-(2-phenylacetyl)oxy-1,4-dioxan-2-yl] 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)O[C@@H]1OCCO[C@H]1OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H20O6/c21-17(13-15-7-3-1-4-8-15)25-19-20(24-12-11-23-19)26-18(22)14-16-9-5-2-6-10-16/h1-10,19-20H,11-14H2/t19-,20-/m0/s1 |
| InChIKey | MWVUIWQNEILNMF-PMACEKPBSA-N |
| XLogP | 2.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |