C33H36O3 — CID 10648417
[(1'R,2'R,4'S)-1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-phenoxy-3-phenylpropanoate (PubChem CID 10648417) has the molecular formula C33H36O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is [(1'R,2'R,4'S)-1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-phenoxy-3-phenylpropanoate.
| Compound Name | [(1'R,2'R,4'S)-1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-phenoxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 10648417 |
| Molecular Formula | C33H36O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | [(1'R,2'R,4'S)-1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-phenoxy-3-phenylpropanoate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](OC(=O)C(Cc1ccccc1)Oc1ccccc1)C21Cc2ccccc2C1 |
| InChI | InChI=1S/C33H36O3/c1-31(2)28-18-19-32(31,3)30(33(28)21-24-14-10-11-15-25(24)22-33)36-29(34)27(20-23-12-6-4-7-13-23)35-26-16-8-5-9-17-26/h4-17,27-28,30H,18-22H2,1-3H3/t27?,28-,30-,32-/m0/s1 |
| InChIKey | VKPRBESSQFWYOP-DFDGZESWSA-N |
| XLogP | 6.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |