C13H15NO3 — CID 101433203
[(1S,6R)-6-hydroxycyclohex-3-en-1-yl] N-phenylcarbamate (PubChem CID 101433203) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is [(1S,6R)-6-hydroxycyclohex-3-en-1-yl] N-phenylcarbamate.
| Compound Name | [(1S,6R)-6-hydroxycyclohex-3-en-1-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 101433203 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | [(1S,6R)-6-hydroxycyclohex-3-en-1-yl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O[C@H]1CC=CC[C@H]1O |
| InChI | InChI=1S/C13H15NO3/c15-11-8-4-5-9-12(11)17-13(16)14-10-6-2-1-3-7-10/h1-7,11-12,15H,8-9H2,(H,14,16)/t11-,12+/m1/s1 |
| InChIKey | WLJUBNLOAVZPBJ-NEPJUHHUSA-N |
| XLogP | 2.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|