About [(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate
[(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate (PubChem CID 7291167) has the molecular formula C15H21N2O5S+
and a molecular weight of 341.41 g/mol. Its IUPAC name is [(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate.
Molecular Properties
| Compound Name | [(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate |
| PubChem CID | 7291167 |
| Molecular Formula | C15H21N2O5S+ |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | [(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O[C@H]1CS(=O)(=O)C[C@@H]1[NH+]1CCOCC1 |
| InChI | InChI=1S/C15H20N2O5S/c18-15(16-12-4-2-1-3-5-12)22-14-11-23(19,20)10-13(14)17-6-8-21-9-7-17/h1-5,13-14H,6-11H2,(H,16,18)/p+1/t13-,14-/m0/s1 |
| InChIKey | JKOWTYIPBIFCRS-KBPBESRZSA-O |
| XLogP | -0.68 |
| TPSA | 86.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate?
The IUPAC name of [(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate (CID 7291167) is [(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate.
What is the SMILES notation for [(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate?
The canonical SMILES for [(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate is O=C(Nc1ccccc1)O[C@H]1CS(=O)(=O)C[C@@H]1[NH+]1CCOCC1.
What is the InChIKey of [(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate?
The InChIKey is JKOWTYIPBIFCRS-KBPBESRZSA-O. The full InChI is InChI=1S/C15H20N2O5S/c18-15(16-12-4-2-1-3-5-12)22-14-11-23(19,20)10-13(14)17-6-8-21-9-7-17/h1-5,13-14H,6-11H2,(H,16,18)/p+1/t13-,14-/m0/s1.
What are the key properties of [(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate?
[(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate has a molecular weight of 341.41 g/mol, XLogP of -0.68, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-4-morpholin-4-ium-4-yl-1,1-dioxothiolan-3-yl] N-phenylcarbamate is sourced from PubChem (CID 7291167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).