C14H15NO3 — CID 23229913
[(1R,2R,3R,4S,5R,6R)-5-hydroxy-3-tricyclo[2.2.1.02,6]heptanyl] N-phenylcarbamate (PubChem CID 23229913) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is [(1R,2R,3R,4S,5R,6R)-5-hydroxy-3-tricyclo[2.2.1.02,6]heptanyl] N-phenylcarbamate.
| Compound Name | [(1R,2R,3R,4S,5R,6R)-5-hydroxy-3-tricyclo[2.2.1.02,6]heptanyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 23229913 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | [(1R,2R,3R,4S,5R,6R)-5-hydroxy-3-tricyclo[2.2.1.02,6]heptanyl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O[C@H]1[C@H]2C[C@@H]3[C@@H]([C@H]2O)[C@@H]31 |
| InChI | InChI=1S/C14H15NO3/c16-12-9-6-8-10(12)11(8)13(9)18-14(17)15-7-4-2-1-3-5-7/h1-5,8-13,16H,6H2,(H,15,17)/t8-,9+,10-,11-,12+,13+/m1/s1 |
| InChIKey | TZXMWOWOUBGAID-ISFYIQIJSA-N |
| XLogP | 1.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |