C14H14FNO3 — CID 10879914
[(1S,2S,3R,4R,5R,6R)-5-fluoro-3-tricyclo[2.2.1.02,6]heptanyl] N-(4-hydroxyphenyl)carbamate (PubChem CID 10879914) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is [(1S,2S,3R,4R,5R,6R)-5-fluoro-3-tricyclo[2.2.1.02,6]heptanyl] N-(4-hydroxyphenyl)carbamate.
| Compound Name | [(1S,2S,3R,4R,5R,6R)-5-fluoro-3-tricyclo[2.2.1.02,6]heptanyl] N-(4-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 10879914 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | [(1S,2S,3R,4R,5R,6R)-5-fluoro-3-tricyclo[2.2.1.02,6]heptanyl] N-(4-hydroxyphenyl)carbamate |
| SMILES | O=C(Nc1ccc(O)cc1)O[C@H]1[C@H]2C[C@@H]3[C@@H]([C@H]2F)[C@H]31 |
| InChI | InChI=1S/C14H14FNO3/c15-12-9-5-8-10(12)11(8)13(9)19-14(18)16-6-1-3-7(17)4-2-6/h1-4,8-13,17H,5H2,(H,16,18)/t8-,9+,10-,11+,12+,13+/m1/s1 |
| InChIKey | VUSSVWKBRJENNZ-XARVFOJUSA-N |
| XLogP | 2.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|