C18H21NO3 — CID 98142011
[(1S,2R,3R,5R,7R,8R,9R)-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] N-(4-methylphenyl)carbamate (PubChem CID 98142011) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is [(1S,2R,3R,5R,7R,8R,9R)-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] N-(4-methylphenyl)carbamate.
| Compound Name | [(1S,2R,3R,5R,7R,8R,9R)-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 98142011 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [(1S,2R,3R,5R,7R,8R,9R)-4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl] N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)O[C@@H]2C[C@@H]3C[C@@H]2[C@H]2C[C@H]4O[C@@H]4[C@H]32)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-9-2-4-11(5-3-9)19-18(20)22-14-7-10-6-12(14)13-8-15-17(21-15)16(10)13/h2-5,10,12-17H,6-8H2,1H3,(H,19,20)/t10-,12+,13+,14+,15+,16+,17-/m0/s1 |
| InChIKey | IMYVWONTZRQAIQ-SDBLRJOLSA-N |
| XLogP | 3.36 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|