C24H38O3Si2 — CID 102243381
[dimethyl(4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl)silyl]oxy-dimethyl-(4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl)silane (PubChem CID 102243381) has the molecular formula C24H38O3Si2 and a molecular weight of 430.74 g/mol. Its IUPAC name is [dimethyl(4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl)silyl]oxy-dimethyl-(4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl)silane.
| Compound Name | [dimethyl(4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl)silyl]oxy-dimethyl-(4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl)silane |
|---|---|
| PubChem CID | 102243381 |
| Molecular Formula | C24H38O3Si2 |
| Molecular Weight | 430.74 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [dimethyl(4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl)silyl]oxy-dimethyl-(4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl)silane |
| SMILES | C[Si](C)(O[Si](C)(C)C1CC2CC1C1CC3OC3C21)C1CC2CC1C1CC3OC3C21 |
| InChI | InChI=1S/C24H38O3Si2/c1-28(2,19-7-11-5-13(19)15-9-17-23(25-17)21(11)15)27-29(3,4)20-8-12-6-14(20)16-10-18-24(26-18)22(12)16/h11-24H,5-10H2,1-4H3 |
| InChIKey | OLSRKNDTYBWEMV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.74 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|