C11H16O2 — CID 142049798
4-oxatetracyclo[6.3.1.02,7.03,5]dodecan-10-ol (PubChem CID 142049798) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-oxatetracyclo[6.3.1.02,7.03,5]dodecan-10-ol.
| Compound Name | 4-oxatetracyclo[6.3.1.02,7.03,5]dodecan-10-ol |
|---|---|
| PubChem CID | 142049798 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 4-oxatetracyclo[6.3.1.02,7.03,5]dodecan-10-ol |
| SMILES | OC1CC2CC(C1)C1C2CC2OC21 |
| InChI | InChI=1S/C11H16O2/c12-7-2-5-1-6(3-7)10-8(5)4-9-11(10)13-9/h5-12H,1-4H2 |
| InChIKey | WPQHLNAUXZFCEY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|