C12H16O — CID 59097462
9-ethenyl-4-oxatetracyclo[6.2.1.02,7.03,5]undecane (PubChem CID 59097462) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 9-ethenyl-4-oxatetracyclo[6.2.1.02,7.03,5]undecane.
| Compound Name | 9-ethenyl-4-oxatetracyclo[6.2.1.02,7.03,5]undecane |
|---|---|
| PubChem CID | 59097462 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 9-ethenyl-4-oxatetracyclo[6.2.1.02,7.03,5]undecane |
| SMILES | C=CC1CC2CC1C1CC3OC3C21 |
| InChI | InChI=1S/C12H16O/c1-2-6-3-7-4-8(6)9-5-10-12(13-10)11(7)9/h2,6-12H,1,3-5H2 |
| InChIKey | OKJJNLDGGBHORU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|