C15H24O3 — CID 144751326
ethane;2-(4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl)ethyl formate (PubChem CID 144751326) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is ethane;2-(4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl)ethyl formate.
| Compound Name | ethane;2-(4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl)ethyl formate |
|---|---|
| PubChem CID | 144751326 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | ethane;2-(4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl)ethyl formate |
| SMILES | CC.O=COCCC1CC2CC1C1CC3OC3C21 |
| InChI | InChI=1S/C13H18O3.C2H6/c14-6-15-2-1-7-3-8-4-9(7)10-5-11-13(16-11)12(8)10;1-2/h6-13H,1-5H2;1-2H3 |
| InChIKey | ZBWWWGCRUGDJGF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|