C14H20O2 — CID 89209334
4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethyl formate (PubChem CID 89209334) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethyl formate.
| Compound Name | 4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethyl formate |
|---|---|
| PubChem CID | 89209334 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethyl formate |
| SMILES | O=COCC1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C14H20O2/c15-7-16-6-11-4-10-5-12(11)14-9-2-1-8(3-9)13(10)14/h7-14H,1-6H2 |
| InChIKey | VCAWFRCMXJYYGG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|