C15H26O2 — CID 159961877
ethanol;4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethanol (PubChem CID 159961877) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is ethanol;4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethanol.
| Compound Name | ethanol;4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethanol |
|---|---|
| PubChem CID | 159961877 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | ethanol;4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethanol |
| SMILES | CCO.OCC1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C13H20O.C2H6O/c14-6-10-4-9-5-11(10)13-8-2-1-7(3-8)12(9)13;1-2-3/h7-14H,1-6H2;3H,2H2,1H3 |
| InChIKey | ODKZXHINPAZUHT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|