C18H26O3 — CID 89204886
[9-(hydroxymethyl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methyl 2-methylprop-2-enoate (PubChem CID 89204886) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is [9-(hydroxymethyl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methyl 2-methylprop-2-enoate.
| Compound Name | [9-(hydroxymethyl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89204886 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | [9-(hydroxymethyl)-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CC2CC1C1C3CC(CO)C(C3)C21 |
| InChI | InChI=1S/C18H26O3/c1-9(2)18(20)21-8-13-4-11-6-15(13)17-10-3-12(7-19)14(5-10)16(11)17/h10-17,19H,1,3-8H2,2H3 |
| InChIKey | WAKOQLVRUVIZNL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|