C21H30O5 — CID 139788272
[8-(2-methylprop-2-enoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl 3-methoxybut-2-enoate (PubChem CID 139788272) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is [8-(2-methylprop-2-enoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl 3-methoxybut-2-enoate.
| Compound Name | [8-(2-methylprop-2-enoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl 3-methoxybut-2-enoate |
|---|---|
| PubChem CID | 139788272 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [8-(2-methylprop-2-enoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl 3-methoxybut-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CC2CC1C1CC(COC(=O)C=C(C)OC)CC21 |
| InChI | InChI=1S/C21H30O5/c1-12(2)21(23)26-11-16-8-15-9-18(16)19-7-14(6-17(15)19)10-25-20(22)5-13(3)24-4/h5,14-19H,1,6-11H2,2-4H3 |
| InChIKey | JIAAJBLKYRWOES-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|