C53H90O6 — CID 88986132
1-O-[7-(2,3-dihexyl-6-octylcyclohexyl)heptyl] 4-O-[[8-(2-methylprop-2-enoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl] (E)-but-2-enedioate (PubChem CID 88986132) has the molecular formula C53H90O6 and a molecular weight of 823.30 g/mol. Its IUPAC name is 1-O-[7-(2,3-dihexyl-6-octylcyclohexyl)heptyl] 4-O-[[8-(2-methylprop-2-enoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl] (E)-but-2-enedioate.
| Compound Name | 1-O-[7-(2,3-dihexyl-6-octylcyclohexyl)heptyl] 4-O-[[8-(2-methylprop-2-enoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 88986132 |
| Molecular Formula | C53H90O6 |
| Molecular Weight | 823.30 g/mol |
| Exact Mass | 822.67 |
| IUPAC Name | 1-O-[7-(2,3-dihexyl-6-octylcyclohexyl)heptyl] 4-O-[[8-(2-methylprop-2-enoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl] (E)-but-2-enedioate |
| SMILES | C=C(C)C(=O)OCC1CC2CC1C1CC(COC(=O)/C=C/C(=O)OCCCCCCCC3C(CCCCCCCC)CCC(CCCCCC)C3CCCCCC)CC21 |
| InChI | InChI=1S/C53H90O6/c1-6-9-12-15-17-21-26-43-30-29-42(25-20-13-10-7-2)46(27-22-14-11-8-3)47(43)28-23-18-16-19-24-33-57-51(54)31-32-52(55)58-38-41-34-48-44-36-45(39-59-53(56)40(4)5)49(37-44)50(48)35-41/h31-32,41-50H,4,6-30,33-39H2,1-3,5H3/b32-31+ |
| InChIKey | CCWYWIAPTJMULO-QNEJGDQOSA-N |
| XLogP | 14.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.30 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|