C68H112O5 — CID 143155742
[4-(3-oxopent-4-enyl)-8-tricyclo[5.2.1.02,6]decanyl]methyl 7-[6-hexyl-2-[7-methylidene-9-[4-(2-methylprop-2-enoyloxymethyl)-8-tricyclo[5.2.1.02,6]decanyl]nonyl]-3-octylcyclohexyl]heptanoate (PubChem CID 143155742) has the molecular formula C68H112O5 and a molecular weight of 1009.64 g/mol. Its IUPAC name is [4-(3-oxopent-4-enyl)-8-tricyclo[5.2.1.02,6]decanyl]methyl 7-[6-hexyl-2-[7-methylidene-9-[4-(2-methylprop-2-enoyloxymethyl)-8-tricyclo[5.2.1.02,6]decanyl]nonyl]-3-octylcyclohexyl]heptanoate.
| Compound Name | [4-(3-oxopent-4-enyl)-8-tricyclo[5.2.1.02,6]decanyl]methyl 7-[6-hexyl-2-[7-methylidene-9-[4-(2-methylprop-2-enoyloxymethyl)-8-tricyclo[5.2.1.02,6]decanyl]nonyl]-3-octylcyclohexyl]heptanoate |
|---|---|
| PubChem CID | 143155742 |
| Molecular Formula | C68H112O5 |
| Molecular Weight | 1009.64 g/mol |
| Exact Mass | 1008.85 |
| IUPAC Name | [4-(3-oxopent-4-enyl)-8-tricyclo[5.2.1.02,6]decanyl]methyl 7-[6-hexyl-2-[7-methylidene-9-[4-(2-methylprop-2-enoyloxymethyl)-8-tricyclo[5.2.1.02,6]decanyl]nonyl]-3-octylcyclohexyl]heptanoate |
| SMILES | C=CC(=O)CCC1CC2C3CC(COC(=O)CCCCCCC4C(CCCCCC)CCC(CCCCCCCC)C4CCCCCCC(=C)CCC4CC5CC4C4CC(COC(=O)C(=C)C)CC54)C(C3)C2C1 |
| InChI | InChI=1S/C68H112O5/c1-7-10-12-14-15-22-28-53-36-35-52(27-21-13-11-8-2)59(30-24-18-19-25-31-67(70)72-47-57-43-56-45-64(57)65-39-50(38-61(56)65)33-37-58(69)9-3)60(53)29-23-17-16-20-26-49(6)32-34-54-42-55-44-63(54)66-41-51(40-62(55)66)46-73-68(71)48(4)5/h9,50-57,59-66H,3-4,6-8,10-47H2,1-2,5H3 |
| InChIKey | AKGKXPDRONQCFN-UHFFFAOYSA-N |
| XLogP | 18.78 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.64 |
| LogP ≤ 5 | 18.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|