C19H26O3 — CID 54552642
[4-(3-oxopent-4-enyl)-8-tricyclo[5.2.1.02,6]decanyl]methyl prop-2-enoate (PubChem CID 54552642) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is [4-(3-oxopent-4-enyl)-8-tricyclo[5.2.1.02,6]decanyl]methyl prop-2-enoate.
| Compound Name | [4-(3-oxopent-4-enyl)-8-tricyclo[5.2.1.02,6]decanyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 54552642 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | [4-(3-oxopent-4-enyl)-8-tricyclo[5.2.1.02,6]decanyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)CCC1CC2C3CC(COC(=O)C=C)C(C3)C2C1 |
| InChI | InChI=1S/C19H26O3/c1-3-15(20)6-5-12-7-16-13-9-14(11-22-19(21)4-2)17(10-13)18(16)8-12/h3-4,12-14,16-18H,1-2,5-11H2 |
| InChIKey | ZKZGMMXCCUDSHI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|